About [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate
[1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate (PubChem CID 19776650) has the molecular formula C20H15N3O5
and a molecular weight of 377.36 g/mol. Its IUPAC name is [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate |
| PubChem CID | 19776650 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate |
| SMILES | Cn1c(=O)c(OC(=O)c2ccc[nH]2)c(OC(=O)c2ccc[nH]2)c2ccccc21 |
| InChI | InChI=1S/C20H15N3O5/c1-23-15-9-3-2-6-12(15)16(27-19(25)13-7-4-10-21-13)17(18(23)24)28-20(26)14-8-5-11-22-14/h2-11,21-22H,1H3 |
| InChIKey | IGUAHCNATHDWCK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate?
The IUPAC name of [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate (CID 19776650) is [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate.
What is the SMILES notation for [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate?
The canonical SMILES for [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate is Cn1c(=O)c(OC(=O)c2ccc[nH]2)c(OC(=O)c2ccc[nH]2)c2ccccc21.
What is the InChIKey of [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate?
The InChIKey is IGUAHCNATHDWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O5/c1-23-15-9-3-2-6-12(15)16(27-19(25)13-7-4-10-21-13)17(18(23)24)28-20(26)14-8-5-11-22-14/h2-11,21-22H,1H3.
What are the key properties of [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate?
[1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate has a molecular weight of 377.36 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-2-oxo-3-(1H-pyrrole-2-carbonyloxy)quinolin-4-yl] 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 19776650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).