About (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate
(4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate (PubChem CID 69182592) has the molecular formula C10H11F2NO2
and a molecular weight of 215.20 g/mol. Its IUPAC name is (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate.
Analyze (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate?
The IUPAC name of (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate (CID 69182592) is (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate.
What is the SMILES notation for (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate?
The canonical SMILES for (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate is CC(CCOC(=O)c1ccc[nH]1)=C(F)F.
What is the InChIKey of (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate?
The InChIKey is GGYIVEQULWPYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2/c1-7(9(11)12)4-6-15-10(14)8-3-2-5-13-8/h2-3,5,13H,4,6H2,1H3.
What are the key properties of (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate?
(4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate has a molecular weight of 215.20 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluoro-3-methylbut-3-enyl) 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 69182592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).