About (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate
(4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate (PubChem CID 8543754) has the molecular formula C12H10ClNO2
and a molecular weight of 235.67 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate |
| PubChem CID | 8543754 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)cc1)c1ccc[nH]1 |
| InChI | InChI=1S/C12H10ClNO2/c13-10-5-3-9(4-6-10)8-16-12(15)11-2-1-7-14-11/h1-7,14H,8H2 |
| InChIKey | RTCLDLSNNQXBSZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate?
The IUPAC name of (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate (CID 8543754) is (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate.
What is the SMILES notation for (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate?
The canonical SMILES for (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate is O=C(OCc1ccc(Cl)cc1)c1ccc[nH]1.
What is the InChIKey of (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate?
The InChIKey is RTCLDLSNNQXBSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO2/c13-10-5-3-9(4-6-10)8-16-12(15)11-2-1-7-14-11/h1-7,14H,8H2.
What are the key properties of (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate?
(4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate has a molecular weight of 235.67 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 8543754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).