About [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate
[2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8550605) has the molecular formula C16H17ClN2O4
and a molecular weight of 336.78 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| PubChem CID | 8550605 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | CN(CCOc1ccc(Cl)cc1)C(=O)COC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C16H17ClN2O4/c1-19(9-10-22-13-6-4-12(17)5-7-13)15(20)11-23-16(21)14-3-2-8-18-14/h2-8,18H,9-11H2,1H3 |
| InChIKey | GVIGQEAGEVUPII-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate?
The IUPAC name of [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate (CID 8550605) is [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate.
What is the SMILES notation for [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate?
The canonical SMILES for [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate is CN(CCOc1ccc(Cl)cc1)C(=O)COC(=O)c1ccc[nH]1.
What is the InChIKey of [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate?
The InChIKey is GVIGQEAGEVUPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2O4/c1-19(9-10-22-13-6-4-12(17)5-7-13)15(20)11-23-16(21)14-3-2-8-18-14/h2-8,18H,9-11H2,1H3.
What are the key properties of [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate?
[2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate has a molecular weight of 336.78 g/mol, XLogP of 2.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(4-chlorophenoxy)ethyl-methylamino]-2-oxoethyl] 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 8550605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).