C12H6F5NO2 — CID 8549709
(2,3,4,5,6-pentafluorophenyl)methyl 1H-pyrrole-2-carboxylate (PubChem CID 8549709) has the molecular formula C12H6F5NO2 and a molecular weight of 291.17 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 1H-pyrrole-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8549709 |
| Molecular Formula | C12H6F5NO2 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCc1c(F)c(F)c(F)c(F)c1F)c1ccc[nH]1 |
| InChI | InChI=1S/C12H6F5NO2/c13-7-5(8(14)10(16)11(17)9(7)15)4-20-12(19)6-2-1-3-18-6/h1-3,18H,4H2 |
| InChIKey | LNIPFXAITSIWJC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|