C15H12N2O4 — CID 8543795
2-(1,3-dioxoisoindol-2-yl)ethyl 1H-pyrrole-2-carboxylate (PubChem CID 8543795) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 1H-pyrrole-2-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8543795 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H12N2O4/c18-13-10-4-1-2-5-11(10)14(19)17(13)8-9-21-15(20)12-6-3-7-16-12/h1-7,16H,8-9H2 |
| InChIKey | RLQPJTAZTGXPSW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|