About (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate
(propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate (PubChem CID 121014544) has the molecular formula C12H15NO5S
and a molecular weight of 285.32 g/mol. Its IUPAC name is (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate |
| PubChem CID | 121014544 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate |
| SMILES | CC(C)=NOC(=O)C(C)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO5S/c1-9(2)13-17-12(14)10(3)18-19(15,16)11-7-5-4-6-8-11/h4-8,10H,1-3H3 |
| InChIKey | ILVOWQUPFJHLQY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate?
The IUPAC name of (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate (CID 121014544) is (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate.
What is the SMILES notation for (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate?
The canonical SMILES for (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate is CC(C)=NOC(=O)C(C)OS(=O)(=O)c1ccccc1.
What is the InChIKey of (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate?
The InChIKey is ILVOWQUPFJHLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO5S/c1-9(2)13-17-12(14)10(3)18-19(15,16)11-7-5-4-6-8-11/h4-8,10H,1-3H3.
What are the key properties of (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate?
(propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate has a molecular weight of 285.32 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) 2-(benzenesulfonyloxy)propanoate is sourced from PubChem (CID 121014544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).