About N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide
N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide (PubChem CID 121016050) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide |
| PubChem CID | 121016050 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(C)cc(C=O)nc2n1 |
| InChI | InChI=1S/C12H11N3O2/c1-7-5-9(6-16)14-12-10(7)3-4-11(15-12)13-8(2)17/h3-6H,1-2H3,(H,13,14,15,17) |
| InChIKey | DFSPGJHBECPJJX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide?
The IUPAC name of N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide (CID 121016050) is N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide.
What is the SMILES notation for N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide?
The canonical SMILES for N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide is CC(=O)Nc1ccc2c(C)cc(C=O)nc2n1.
What is the InChIKey of N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide?
The InChIKey is DFSPGJHBECPJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c1-7-5-9(6-16)14-12-10(7)3-4-11(15-12)13-8(2)17/h3-6H,1-2H3,(H,13,14,15,17).
What are the key properties of N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide?
N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide has a molecular weight of 229.24 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide is sourced from PubChem (CID 121016050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).