C12H11N3O2 — CID 121016050
N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide (PubChem CID 121016050) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide.
| Compound Name | N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 121016050 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(7-formyl-5-methyl-1,8-naphthyridin-2-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(C)cc(C=O)nc2n1 |
| InChI | InChI=1S/C12H11N3O2/c1-7-5-9(6-16)14-12-10(7)3-4-11(15-12)13-8(2)17/h3-6H,1-2H3,(H,13,14,15,17) |
| InChIKey | DFSPGJHBECPJJX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|