C19H15N3OS6 — CID 102485370
2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-N-(5,7-dimethyl-1,8-naphthyridin-2-yl)-1,3-dithiole-4-carboxamide (PubChem CID 102485370) has the molecular formula C19H15N3OS6 and a molecular weight of 493.75 g/mol. Its IUPAC name is 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-N-(5,7-dimethyl-1,8-naphthyridin-2-yl)-1,3-dithiole-4-carboxamide.
| Compound Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-N-(5,7-dimethyl-1,8-naphthyridin-2-yl)-1,3-dithiole-4-carboxamide |
|---|---|
| PubChem CID | 102485370 |
| Molecular Formula | C19H15N3OS6 |
| Molecular Weight | 493.75 g/mol |
| Exact Mass | 492.95 |
| IUPAC Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-N-(5,7-dimethyl-1,8-naphthyridin-2-yl)-1,3-dithiole-4-carboxamide |
| SMILES | Cc1cc(C)c2ccc(NC(=O)C3=CSC(=C4SC5=C(SCCS5)S4)S3)nc2n1 |
| InChI | InChI=1S/C19H15N3OS6/c1-9-7-10(2)20-14-11(9)3-4-13(21-14)22-15(23)12-8-26-18(27-12)19-28-16-17(29-19)25-6-5-24-16/h3-4,7-8H,5-6H2,1-2H3,(H,20,21,22,23) |
| InChIKey | GWTKMZCCNUGYRO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |