C15H20N2O4 — CID 121017457
oxan-4-yl 3-pyridin-4-yloxypyrrolidine-1-carboxylate (PubChem CID 121017457) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is oxan-4-yl 3-pyridin-4-yloxypyrrolidine-1-carboxylate.
| Compound Name | oxan-4-yl 3-pyridin-4-yloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121017457 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | oxan-4-yl 3-pyridin-4-yloxypyrrolidine-1-carboxylate |
| SMILES | O=C(OC1CCOCC1)N1CCC(Oc2ccncc2)C1 |
| InChI | InChI=1S/C15H20N2O4/c18-15(21-13-4-9-19-10-5-13)17-8-3-14(11-17)20-12-1-6-16-7-2-12/h1-2,6-7,13-14H,3-5,8-11H2 |
| InChIKey | UVMWJFWQXBRKDZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |