C20H21NO2S2 — CID 121019439
N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 121019439) has the molecular formula C20H21NO2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121019439 |
| Molecular Formula | C20H21NO2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(NCCc1ccc(-c2ccoc2)s1)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C20H21NO2S2/c22-19(20(9-1-2-10-20)18-4-3-13-24-18)21-11-7-16-5-6-17(25-16)15-8-12-23-14-15/h3-6,8,12-14H,1-2,7,9-11H2,(H,21,22) |
| InChIKey | DRISVCWMQARQQA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |