C20H20N2O3S — CID 129355793
N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-N'-[(1S)-1-phenylethyl]oxamide (PubChem CID 129355793) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-N'-[(1S)-1-phenylethyl]oxamide.
| Compound Name | N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-N'-[(1S)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 129355793 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[2-[5-(furan-3-yl)thiophen-2-yl]ethyl]-N'-[(1S)-1-phenylethyl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)NCCc1ccc(-c2ccoc2)s1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-14(15-5-3-2-4-6-15)22-20(24)19(23)21-11-9-17-7-8-18(26-17)16-10-12-25-13-16/h2-8,10,12-14H,9,11H2,1H3,(H,21,23)(H,22,24)/t14-/m0/s1 |
| InChIKey | APQZNNDRKPJACQ-AWEZNQCLSA-N |
| XLogP | 3.54 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|