C17H18N6O4S — CID 121020043
2-[4-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methylsulfamoyl]phenoxy]acetamide (PubChem CID 121020043) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[4-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methylsulfamoyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methylsulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 121020043 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-[4-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methylsulfamoyl]phenoxy]acetamide |
| SMILES | Cn1nc(-c2cnccn2)cc1CNS(=O)(=O)c1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C17H18N6O4S/c1-23-12(8-15(22-23)16-10-19-6-7-20-16)9-21-28(25,26)14-4-2-13(3-5-14)27-11-17(18)24/h2-8,10,21H,9,11H2,1H3,(H2,18,24) |
| InChIKey | KTEBYAAVAHNXMG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |