C9H11N5OS — CID 121020856
5-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbohydrazide (PubChem CID 121020856) has the molecular formula C9H11N5OS and a molecular weight of 237.29 g/mol. Its IUPAC name is 5-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbohydrazide.
| Compound Name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 121020856 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-pyrazole-3-carbohydrazide |
| SMILES | Cc1nc(C)c(-c2cc(C(=O)NN)n[nH]2)s1 |
| InChI | InChI=1S/C9H11N5OS/c1-4-8(16-5(2)11-4)6-3-7(14-13-6)9(15)12-10/h3H,10H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | FEVAKFOKXAKLMD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|