C15H12N6O4S — CID 121025951
3-(furan-2-ylmethyl)-2,4-dioxo-N-([1,3]thiazolo[3,2-b][1,2,4]triazol-6-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 121025951) has the molecular formula C15H12N6O4S and a molecular weight of 372.37 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2,4-dioxo-N-([1,3]thiazolo[3,2-b][1,2,4]triazol-6-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-(furan-2-ylmethyl)-2,4-dioxo-N-([1,3]thiazolo[3,2-b][1,2,4]triazol-6-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121025951 |
| Molecular Formula | C15H12N6O4S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2,4-dioxo-N-([1,3]thiazolo[3,2-b][1,2,4]triazol-6-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1csc2ncnn12)c1c[nH]c(=O)n(Cc2ccco2)c1=O |
| InChI | InChI=1S/C15H12N6O4S/c22-12(16-4-9-7-26-15-18-8-19-21(9)15)11-5-17-14(24)20(13(11)23)6-10-2-1-3-25-10/h1-3,5,7-8H,4,6H2,(H,16,22)(H,17,24) |
| InChIKey | MTKHRUFCJKWPTI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |