C21H14FN3O5 — CID 121026804
3-[(2-fluorophenyl)methyl]-2,4-dioxo-N-(2-oxochromen-3-yl)-1H-pyrimidine-5-carboxamide (PubChem CID 121026804) has the molecular formula C21H14FN3O5 and a molecular weight of 407.36 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-2,4-dioxo-N-(2-oxochromen-3-yl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-[(2-fluorophenyl)methyl]-2,4-dioxo-N-(2-oxochromen-3-yl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121026804 |
| Molecular Formula | C21H14FN3O5 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-2,4-dioxo-N-(2-oxochromen-3-yl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1cc2ccccc2oc1=O)c1c[nH]c(=O)n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C21H14FN3O5/c22-15-7-3-1-6-13(15)11-25-19(27)14(10-23-21(25)29)18(26)24-16-9-12-5-2-4-8-17(12)30-20(16)28/h1-10H,11H2,(H,23,29)(H,24,26) |
| InChIKey | AUZZDQOVPJCPNR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|