C19H15FN4O5 — CID 121026849
3-[(2-fluorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121026849) has the molecular formula C19H15FN4O5 and a molecular weight of 398.35 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-[(2-fluorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121026849 |
| Molecular Formula | C19H15FN4O5 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1c[nH]c(=O)n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C19H15FN4O5/c1-11-6-7-13(24(28)29)8-16(11)22-17(25)14-9-21-19(27)23(18(14)26)10-12-4-2-3-5-15(12)20/h2-9H,10H2,1H3,(H,21,27)(H,22,25) |
| InChIKey | VQMDATMAZRBRHG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|