C20H16N4O7 — CID 121027415
3-(1,3-benzodioxol-5-ylmethyl)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121027415) has the molecular formula C20H16N4O7 and a molecular weight of 424.37 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121027415 |
| Molecular Formula | C20H16N4O7 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)c1c[nH]c(=O)n(Cc2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C20H16N4O7/c1-11-6-13(24(28)29)3-4-15(11)22-18(25)14-8-21-20(27)23(19(14)26)9-12-2-5-16-17(7-12)31-10-30-16/h2-8H,9-10H2,1H3,(H,21,27)(H,22,25) |
| InChIKey | QYKYRMIXZLWNGV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|