C21H17N3O7 — CID 121027390
N,3-bis(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121027390) has the molecular formula C21H17N3O7 and a molecular weight of 423.38 g/mol. Its IUPAC name is N,3-bis(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N,3-bis(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121027390 |
| Molecular Formula | C21H17N3O7 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N,3-bis(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1c[nH]c(=O)n(Cc2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C21H17N3O7/c25-19(22-7-12-1-3-15-17(5-12)30-10-28-15)14-8-23-21(27)24(20(14)26)9-13-2-4-16-18(6-13)31-11-29-16/h1-6,8H,7,9-11H2,(H,22,25)(H,23,27) |
| InChIKey | DKBZKEYZGPLGIF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |