C22H18F3N3O6 — CID 121027574
3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1H-pyrimidine-5-carboxamide (PubChem CID 121027574) has the molecular formula C22H18F3N3O6 and a molecular weight of 477.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121027574 |
| Molecular Formula | C22H18F3N3O6 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCOc1cccc(C(F)(F)F)c1)c1c[nH]c(=O)n(Cc2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C22H18F3N3O6/c23-22(24,25)14-2-1-3-15(9-14)32-7-6-26-19(29)16-10-27-21(31)28(20(16)30)11-13-4-5-17-18(8-13)34-12-33-17/h1-5,8-10H,6-7,11-12H2,(H,26,29)(H,27,31) |
| InChIKey | YWHUPNHKKLTZBS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|