C25H24FN5O5 — CID 121026869
N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-3-[(2-fluorophenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121026869) has the molecular formula C25H24FN5O5 and a molecular weight of 493.50 g/mol. Its IUPAC name is N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-3-[(2-fluorophenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-3-[(2-fluorophenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121026869 |
| Molecular Formula | C25H24FN5O5 |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-3-[(2-fluorophenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1c[nH]c(=O)n(Cc2ccccc2F)c1=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C25H24FN5O5/c26-20-4-2-1-3-17(20)14-31-24(35)19(13-29-25(31)36)23(34)28-12-11-27-21(32)15-7-9-18(10-8-15)30-22(33)16-5-6-16/h1-4,7-10,13,16H,5-6,11-12,14H2,(H,27,32)(H,28,34)(H,29,36)(H,30,33) |
| InChIKey | YYGUQRPVEJJAFT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|