C23H23N5O5S — CID 71778406
N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 71778406) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71778406 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]ethyl]-2,4-dioxo-3-(thiophen-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1c[nH]c(=O)n(Cc2cccs2)c1=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C23H23N5O5S/c29-19(14-5-7-16(8-6-14)27-20(30)15-3-4-15)24-9-10-25-21(31)18-12-26-23(33)28(22(18)32)13-17-2-1-11-34-17/h1-2,5-8,11-12,15H,3-4,9-10,13H2,(H,24,29)(H,25,31)(H,26,33)(H,27,30) |
| InChIKey | LBPTZELPSWIPQV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|