C23H24N8O2 — CID 121028020
N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]-6-piperidin-1-ylpyridazine-3-carboxamide (PubChem CID 121028020) has the molecular formula C23H24N8O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]-6-piperidin-1-ylpyridazine-3-carboxamide.
| Compound Name | N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]-6-piperidin-1-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 121028020 |
| Molecular Formula | C23H24N8O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[2-[(3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]ethyl]-6-piperidin-1-ylpyridazine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc2nnc(-c3ccccc3)n2n1)c1ccc(N2CCCCC2)nn1 |
| InChI | InChI=1S/C23H24N8O2/c32-23(18-9-10-19(26-25-18)30-14-5-2-6-15-30)24-13-16-33-21-12-11-20-27-28-22(31(20)29-21)17-7-3-1-4-8-17/h1,3-4,7-12H,2,5-6,13-16H2,(H,24,32) |
| InChIKey | HMZAYRIOKKZBHG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|