C16H16Cl2N4O2 — CID 121028270
N-[(2,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyridazine-3-carboxamide (PubChem CID 121028270) has the molecular formula C16H16Cl2N4O2 and a molecular weight of 367.24 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyridazine-3-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 121028270 |
| Molecular Formula | C16H16Cl2N4O2 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-6-morpholin-4-ylpyridazine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)c1ccc(N2CCOCC2)nn1 |
| InChI | InChI=1S/C16H16Cl2N4O2/c17-12-2-1-11(13(18)9-12)10-19-16(23)14-3-4-15(21-20-14)22-5-7-24-8-6-22/h1-4,9H,5-8,10H2,(H,19,23) |
| InChIKey | VNMVXOOYHVQHQC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |