C22H21ClN6O3 — CID 121032316
2-chloro-N-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]-4-nitrobenzamide (PubChem CID 121032316) has the molecular formula C22H21ClN6O3 and a molecular weight of 452.90 g/mol. Its IUPAC name is 2-chloro-N-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 121032316 |
| Molecular Formula | C22H21ClN6O3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-chloro-N-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]-4-nitrobenzamide |
| SMILES | Cc1cc(N2CCCC2)nc(Nc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)cc2)n1 |
| InChI | InChI=1S/C22H21ClN6O3/c1-14-12-20(28-10-2-3-11-28)27-22(24-14)26-16-6-4-15(5-7-16)25-21(30)18-9-8-17(29(31)32)13-19(18)23/h4-9,12-13H,2-3,10-11H2,1H3,(H,25,30)(H,24,26,27) |
| InChIKey | POXOHXJSLJNZJZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|