C18H18N2O3S — CID 121034883
methyl 7-[[(E)-3-thiophen-3-ylprop-2-enoyl]amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 121034883) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 7-[[(E)-3-thiophen-3-ylprop-2-enoyl]amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl 7-[[(E)-3-thiophen-3-ylprop-2-enoyl]amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 121034883 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | methyl 7-[[(E)-3-thiophen-3-ylprop-2-enoyl]amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)N1CCc2ccc(NC(=O)/C=C/c3ccsc3)cc2C1 |
| InChI | InChI=1S/C18H18N2O3S/c1-23-18(22)20-8-6-14-3-4-16(10-15(14)11-20)19-17(21)5-2-13-7-9-24-12-13/h2-5,7,9-10,12H,6,8,11H2,1H3,(H,19,21)/b5-2+ |
| InChIKey | OJZLHIRMLQTPLG-GORDUTHDSA-N |
| XLogP | 3.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|