C18H21N3O3S2 — CID 60582072
(E)-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-thiophen-3-ylprop-2-enamide (PubChem CID 60582072) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (E)-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 60582072 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (E)-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-3-thiophen-3-ylprop-2-enamide |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(NC(=O)/C=C/c3ccsc3)c2)CC1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-20-8-10-21(11-9-20)26(23,24)17-4-2-3-16(13-17)19-18(22)6-5-15-7-12-25-14-15/h2-7,12-14H,8-11H2,1H3,(H,19,22)/b6-5+ |
| InChIKey | GJBDFPACIOOXTG-AATRIKPKSA-N |
| XLogP | 2.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|