C17H28N4O3S — CID 119864454
2-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pentanamide (PubChem CID 119864454) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pentanamide.
| Compound Name | 2-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pentanamide |
|---|---|
| PubChem CID | 119864454 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pentanamide |
| SMILES | CCCC(C)(N)C(=O)Nc1cccc(S(=O)(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C17H28N4O3S/c1-4-8-17(2,18)16(22)19-14-6-5-7-15(13-14)25(23,24)21-11-9-20(3)10-12-21/h5-7,13H,4,8-12,18H2,1-3H3,(H,19,22) |
| InChIKey | RBFRTLNXTQHSHK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |