C23H15N7O3 — CID 121036502
4-nitro-N-[3-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide (PubChem CID 121036502) has the molecular formula C23H15N7O3 and a molecular weight of 437.42 g/mol. Its IUPAC name is 4-nitro-N-[3-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide.
| Compound Name | 4-nitro-N-[3-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 121036502 |
| Molecular Formula | C23H15N7O3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 4-nitro-N-[3-(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc3nnc(-c4cccnc4)n3n2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H15N7O3/c31-23(15-6-8-19(9-7-15)30(32)33)25-18-5-1-3-16(13-18)20-10-11-21-26-27-22(29(21)28-20)17-4-2-12-24-14-17/h1-14H,(H,25,31) |
| InChIKey | KRODISCJRDQJSV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|