C23H14ClN7O3 — CID 16873282
5-chloro-2-nitro-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide (PubChem CID 16873282) has the molecular formula C23H14ClN7O3 and a molecular weight of 471.86 g/mol. Its IUPAC name is 5-chloro-2-nitro-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide.
| Compound Name | 5-chloro-2-nitro-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 16873282 |
| Molecular Formula | C23H14ClN7O3 |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 5-chloro-2-nitro-N-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc3nnc(-c4ccncc4)n3n2)c1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H14ClN7O3/c24-16-4-6-20(31(33)34)18(13-16)23(32)26-17-3-1-2-15(12-17)19-5-7-21-27-28-22(30(21)29-19)14-8-10-25-11-9-14/h1-13H,(H,26,32) |
| InChIKey | FZYHPABDPTZIJK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|