C24H22ClN5O3S — CID 121038565
4-acetamido-N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]benzamide (PubChem CID 121038565) has the molecular formula C24H22ClN5O3S and a molecular weight of 495.99 g/mol. Its IUPAC name is 4-acetamido-N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]benzamide.
| Compound Name | 4-acetamido-N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121038565 |
| Molecular Formula | C24H22ClN5O3S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 4-acetamido-N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NCCNC(=O)Cc2csc3nc(-c4ccc(Cl)cc4)cn23)cc1 |
| InChI | InChI=1S/C24H22ClN5O3S/c1-15(31)28-19-8-4-17(5-9-19)23(33)27-11-10-26-22(32)12-20-14-34-24-29-21(13-30(20)24)16-2-6-18(25)7-3-16/h2-9,13-14H,10-12H2,1H3,(H,26,32)(H,27,33)(H,28,31) |
| InChIKey | UZEAEPLHFZGTBN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|