C25H24ClN5O3S — CID 121038566
N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide (PubChem CID 121038566) has the molecular formula C25H24ClN5O3S and a molecular weight of 510.02 g/mol. Its IUPAC name is N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide.
| Compound Name | N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 121038566 |
| Molecular Formula | C25H24ClN5O3S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | N-[2-[[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetyl]amino]ethyl]-4-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NCCNC(=O)Cc2csc3nc(-c4ccc(Cl)cc4)cn23)cc1 |
| InChI | InChI=1S/C25H24ClN5O3S/c1-2-22(32)29-19-9-5-17(6-10-19)24(34)28-12-11-27-23(33)13-20-15-35-25-30-21(14-31(20)25)16-3-7-18(26)8-4-16/h3-10,14-15H,2,11-13H2,1H3,(H,27,33)(H,28,34)(H,29,32) |
| InChIKey | ILSOPAQENIKIGO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|