C25H28N4O2S — CID 121038619
N-[4-(diethylamino)-2-methylphenyl]-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide (PubChem CID 121038619) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 121038619 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-[6-(4-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cc2csc3nc(-c4ccc(OC)cc4)cn23)c(C)c1 |
| InChI | InChI=1S/C25H28N4O2S/c1-5-28(6-2)19-9-12-22(17(3)13-19)26-24(30)14-20-16-32-25-27-23(15-29(20)25)18-7-10-21(31-4)11-8-18/h7-13,15-16H,5-6,14H2,1-4H3,(H,26,30) |
| InChIKey | DBERSPYSFJZQCA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|