C24H19ClN2O4S — CID 121044893
4-[(4-chlorophenyl)sulfonylamino]-N-(4-methoxynaphthalen-1-yl)benzamide (PubChem CID 121044893) has the molecular formula C24H19ClN2O4S and a molecular weight of 466.95 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonylamino]-N-(4-methoxynaphthalen-1-yl)benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(4-methoxynaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 121044893 |
| Molecular Formula | C24H19ClN2O4S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(4-methoxynaphthalen-1-yl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H19ClN2O4S/c1-31-23-15-14-22(20-4-2-3-5-21(20)23)26-24(28)16-6-10-18(11-7-16)27-32(29,30)19-12-8-17(25)9-13-19/h2-15,27H,1H3,(H,26,28) |
| InChIKey | RMWUIALJZBGPQO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |