C23H21N5O4S — CID 121050363
2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide (PubChem CID 121050363) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide |
|---|---|
| PubChem CID | 121050363 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CC(=O)NCCOc3ccc(-c4cccs4)nn3)n2)cc1 |
| InChI | InChI=1S/C23H21N5O4S/c1-31-17-6-4-16(5-7-17)18-9-11-23(30)28(27-18)15-21(29)24-12-13-32-22-10-8-19(25-26-22)20-3-2-14-33-20/h2-11,14H,12-13,15H2,1H3,(H,24,29) |
| InChIKey | MIFFQPACRRHTEU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|