C22H18BrN5O3S — CID 121051123
2-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide (PubChem CID 121051123) has the molecular formula C22H18BrN5O3S and a molecular weight of 512.39 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide.
| Compound Name | 2-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide |
|---|---|
| PubChem CID | 121051123 |
| Molecular Formula | C22H18BrN5O3S |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 2-[3-(4-bromophenyl)-6-oxopyridazin-1-yl]-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccc(Br)cc2)ccc1=O)NCCOc1ccc(-c2cccs2)nn1 |
| InChI | InChI=1S/C22H18BrN5O3S/c23-16-5-3-15(4-6-16)17-8-10-22(30)28(27-17)14-20(29)24-11-12-31-21-9-7-18(25-26-21)19-2-1-13-32-19/h1-10,13H,11-12,14H2,(H,24,29) |
| InChIKey | YWHLYOLWONMYPZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|