C19H19N3O2S2 — CID 41246801
2-benzylsulfanyl-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide (PubChem CID 41246801) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide |
|---|---|
| PubChem CID | 41246801 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-benzylsulfanyl-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]acetamide |
| SMILES | O=C(CSCc1ccccc1)NCCOc1ccc(-c2cccs2)nn1 |
| InChI | InChI=1S/C19H19N3O2S2/c23-18(14-25-13-15-5-2-1-3-6-15)20-10-11-24-19-9-8-16(21-22-19)17-7-4-12-26-17/h1-9,12H,10-11,13-14H2,(H,20,23) |
| InChIKey | QMLGDOXUGJOMES-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|