C15H12BrN3O3S — CID 41246804
5-bromo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]furan-2-carboxamide (PubChem CID 41246804) has the molecular formula C15H12BrN3O3S and a molecular weight of 394.25 g/mol. Its IUPAC name is 5-bromo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 41246804 |
| Molecular Formula | C15H12BrN3O3S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 5-bromo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]furan-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(-c2cccs2)nn1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H12BrN3O3S/c16-13-5-4-11(22-13)15(20)17-7-8-21-14-6-3-10(18-19-14)12-2-1-9-23-12/h1-6,9H,7-8H2,(H,17,20) |
| InChIKey | DRXUCYJXSLHJFM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|