C22H19N3O5S — CID 41246831
8-ethoxy-2-oxo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]chromene-3-carboxamide (PubChem CID 41246831) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 8-ethoxy-2-oxo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]chromene-3-carboxamide.
| Compound Name | 8-ethoxy-2-oxo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 41246831 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 8-ethoxy-2-oxo-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]chromene-3-carboxamide |
| SMILES | CCOc1cccc2cc(C(=O)NCCOc3ccc(-c4cccs4)nn3)c(=O)oc12 |
| InChI | InChI=1S/C22H19N3O5S/c1-2-28-17-6-3-5-14-13-15(22(27)30-20(14)17)21(26)23-10-11-29-19-9-8-16(24-25-19)18-7-4-12-31-18/h3-9,12-13H,2,10-11H2,1H3,(H,23,26) |
| InChIKey | IUBPLYAAMTZMHB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|