C25H23N3O2 — CID 121051397
N-ethyl-N-(2-methylphenyl)-2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)acetamide (PubChem CID 121051397) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-ethyl-N-(2-methylphenyl)-2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)acetamide.
| Compound Name | N-ethyl-N-(2-methylphenyl)-2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 121051397 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-ethyl-N-(2-methylphenyl)-2-(3-naphthalen-2-yl-6-oxopyridazin-1-yl)acetamide |
| SMILES | CCN(C(=O)Cn1nc(-c2ccc3ccccc3c2)ccc1=O)c1ccccc1C |
| InChI | InChI=1S/C25H23N3O2/c1-3-27(23-11-7-4-8-18(23)2)25(30)17-28-24(29)15-14-22(26-28)21-13-12-19-9-5-6-10-20(19)16-21/h4-16H,3,17H2,1-2H3 |
| InChIKey | KQUVXMBQLFGVAI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |