C18H15ClN4O4S — CID 121051659
2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 121051659) has the molecular formula C18H15ClN4O4S and a molecular weight of 418.86 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 121051659 |
| Molecular Formula | C18H15ClN4O4S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2nc(-c3ccc(Cl)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C18H15ClN4O4S/c19-13-3-1-12(2-4-13)16-9-10-18(25)23(22-16)11-17(24)21-14-5-7-15(8-6-14)28(20,26)27/h1-10H,11H2,(H,21,24)(H2,20,26,27) |
| InChIKey | ONSVBAFVFFDINC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |