C18H15ClN4O2 — CID 121052428
N-(3-chloro-4-methylphenyl)-2-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)acetamide (PubChem CID 121052428) has the molecular formula C18H15ClN4O2 and a molecular weight of 354.80 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 121052428 |
| Molecular Formula | C18H15ClN4O2 |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nc(-c3cccnc3)ccc2=O)cc1Cl |
| InChI | InChI=1S/C18H15ClN4O2/c1-12-4-5-14(9-15(12)19)21-17(24)11-23-18(25)7-6-16(22-23)13-3-2-8-20-10-13/h2-10H,11H2,1H3,(H,21,24) |
| InChIKey | NXCKPLPSHIHELK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |