C17H14N4O2 — CID 44754046
2-(6-oxo-3-phenylpyridazin-1-yl)-N-pyridin-3-ylacetamide (PubChem CID 44754046) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-(6-oxo-3-phenylpyridazin-1-yl)-N-pyridin-3-ylacetamide.
| Compound Name | 2-(6-oxo-3-phenylpyridazin-1-yl)-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 44754046 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-(6-oxo-3-phenylpyridazin-1-yl)-N-pyridin-3-ylacetamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)ccc1=O)Nc1cccnc1 |
| InChI | InChI=1S/C17H14N4O2/c22-16(19-14-7-4-10-18-11-14)12-21-17(23)9-8-15(20-21)13-5-2-1-3-6-13/h1-11H,12H2,(H,19,22) |
| InChIKey | UYWKLHCTGYZVLD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |