C17H13FN4O2 — CID 121052752
N-(4-fluorophenyl)-2-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)acetamide (PubChem CID 121052752) has the molecular formula C17H13FN4O2 and a molecular weight of 324.32 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 121052752 |
| Molecular Formula | C17H13FN4O2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(4-fluorophenyl)-2-(6-oxo-3-pyridin-4-ylpyridazin-1-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2ccncc2)ccc1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN4O2/c18-13-1-3-14(4-2-13)20-16(23)11-22-17(24)6-5-15(21-22)12-7-9-19-10-8-12/h1-10H,11H2,(H,20,23) |
| InChIKey | KHYBBBNSPFYVOG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |