C22H21FN4O3 — CID 27518001
N-[5-[1-[2-(4-fluoroanilino)-2-oxoethyl]-6-oxopyridazin-3-yl]-2-methylphenyl]propanamide (PubChem CID 27518001) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[5-[1-[2-(4-fluoroanilino)-2-oxoethyl]-6-oxopyridazin-3-yl]-2-methylphenyl]propanamide.
| Compound Name | N-[5-[1-[2-(4-fluoroanilino)-2-oxoethyl]-6-oxopyridazin-3-yl]-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 27518001 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[5-[1-[2-(4-fluoroanilino)-2-oxoethyl]-6-oxopyridazin-3-yl]-2-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(-c2ccc(=O)n(CC(=O)Nc3ccc(F)cc3)n2)ccc1C |
| InChI | InChI=1S/C22H21FN4O3/c1-3-20(28)25-19-12-15(5-4-14(19)2)18-10-11-22(30)27(26-18)13-21(29)24-17-8-6-16(23)7-9-17/h4-12H,3,13H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | OFLSWDIMRYPCEF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |