C20H24IN5O2 — CID 121053676
(2-iodophenyl)-[4-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 121053676) has the molecular formula C20H24IN5O2 and a molecular weight of 493.35 g/mol. Its IUPAC name is (2-iodophenyl)-[4-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121053676 |
| Molecular Formula | C20H24IN5O2 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | (2-iodophenyl)-[4-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1I)N1CCN(c2ccc(NCC3CCCO3)nn2)CC1 |
| InChI | InChI=1S/C20H24IN5O2/c21-17-6-2-1-5-16(17)20(27)26-11-9-25(10-12-26)19-8-7-18(23-24-19)22-14-15-4-3-13-28-15/h1-2,5-8,15H,3-4,9-14H2,(H,22,23) |
| InChIKey | BKNJSYWNNXTGOF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|