C18H19IN4O — CID 122279263
[4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]-(2-iodophenyl)methanone (PubChem CID 122279263) has the molecular formula C18H19IN4O and a molecular weight of 434.28 g/mol. Its IUPAC name is [4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]-(2-iodophenyl)methanone.
| Compound Name | [4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 122279263 |
| Molecular Formula | C18H19IN4O |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [4-(6-cyclopropylpyridazin-3-yl)piperazin-1-yl]-(2-iodophenyl)methanone |
| SMILES | O=C(c1ccccc1I)N1CCN(c2ccc(C3CC3)nn2)CC1 |
| InChI | InChI=1S/C18H19IN4O/c19-15-4-2-1-3-14(15)18(24)23-11-9-22(10-12-23)17-8-7-16(20-21-17)13-5-6-13/h1-4,7-8,13H,5-6,9-12H2 |
| InChIKey | VSRVDPDQUSSCPC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|