C16H16N6O2S — CID 121058795
[4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 121058795) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is [4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 121058795 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCN(c2ccc(-c3ccco3)nn2)CC1 |
| InChI | InChI=1S/C16H16N6O2S/c1-11-15(25-20-17-11)16(23)22-8-6-21(7-9-22)14-5-4-12(18-19-14)13-3-2-10-24-13/h2-5,10H,6-9H2,1H3 |
| InChIKey | VMVFOBATOKBAIC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |