C21H22N4O2S — CID 41233208
1-[4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-3-phenylsulfanylpropan-1-one (PubChem CID 41233208) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-3-phenylsulfanylpropan-1-one.
| Compound Name | 1-[4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-3-phenylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 41233208 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[4-[6-(furan-2-yl)pyridazin-3-yl]piperazin-1-yl]-3-phenylsulfanylpropan-1-one |
| SMILES | O=C(CCSc1ccccc1)N1CCN(c2ccc(-c3ccco3)nn2)CC1 |
| InChI | InChI=1S/C21H22N4O2S/c26-21(10-16-28-17-5-2-1-3-6-17)25-13-11-24(12-14-25)20-9-8-18(22-23-20)19-7-4-15-27-19/h1-9,15H,10-14,16H2 |
| InChIKey | CKFZTFKHNVFTOB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |