C14H13F2N3O2 — CID 121058993
3,4-difluoro-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]benzamide (PubChem CID 121058993) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]benzamide.
| Compound Name | 3,4-difluoro-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 121058993 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3,4-difluoro-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]benzamide |
| SMILES | Cc1ccc(=O)n(CCNC(=O)c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H13F2N3O2/c1-9-2-5-13(20)19(18-9)7-6-17-14(21)10-3-4-11(15)12(16)8-10/h2-5,8H,6-7H2,1H3,(H,17,21) |
| InChIKey | HMMFZFTYTKJWIG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |